C26H22FNO3S — CID 71965326
2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 71965326) has the molecular formula C26H22FNO3S and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 71965326 |
| Molecular Formula | C26H22FNO3S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CC1=C(CC(=O)Nc2ccc(O)cc2)c2cc(F)ccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C26H22FNO3S/c1-16-23(13-17-3-10-21(11-4-17)32(2)31)22-12-5-18(27)14-25(22)24(16)15-26(30)28-19-6-8-20(29)9-7-19/h3-14,29H,15H2,1-2H3,(H,28,30) |
| InChIKey | INXJGLQKAJFXIC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|