C26H31FNO5PS — CID 59810610
N-(2-diethoxyphosphorylethyl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide (PubChem CID 59810610) has the molecular formula C26H31FNO5PS and a molecular weight of 519.58 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylethyl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide.
| Compound Name | N-(2-diethoxyphosphorylethyl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide |
|---|---|
| PubChem CID | 59810610 |
| Molecular Formula | C26H31FNO5PS |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-(2-diethoxyphosphorylethyl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide |
| SMILES | CCOP(=O)(CCNC(=O)CC1=C(C)/C(=C/c2ccc(S(C)=O)cc2)c2ccc(F)cc21)OCC |
| InChI | InChI=1S/C26H31FNO5PS/c1-5-32-34(30,33-6-2)14-13-28-26(29)17-24-18(3)23(22-12-9-20(27)16-25(22)24)15-19-7-10-21(11-8-19)35(4)31/h7-12,15-16H,5-6,13-14,17H2,1-4H3,(H,28,29)/b23-15- |
| InChIKey | YWUYCYXURFQEFG-HAHDFKILSA-N |
| XLogP | 5.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|