C29H26FNO4S — CID 70150631
benzyl 2-[[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]acetate (PubChem CID 70150631) has the molecular formula C29H26FNO4S and a molecular weight of 503.60 g/mol. Its IUPAC name is benzyl 2-[[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]acetate.
| Compound Name | benzyl 2-[[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 70150631 |
| Molecular Formula | C29H26FNO4S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | benzyl 2-[[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]acetate |
| SMILES | CC1=C(CC(=O)NCC(=O)OCc2ccccc2)c2cc(F)ccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C29H26FNO4S/c1-19-25(14-20-8-11-23(12-9-20)36(2)34)24-13-10-22(30)15-27(24)26(19)16-28(32)31-17-29(33)35-18-21-6-4-3-5-7-21/h3-15H,16-18H2,1-2H3,(H,31,32) |
| InChIKey | SCZMFRUQJYRTHQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|