C25H31FO2S — CID 177352787
ethane;1-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]propan-2-one (PubChem CID 177352787) has the molecular formula C25H31FO2S and a molecular weight of 414.59 g/mol. Its IUPAC name is ethane;1-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]propan-2-one.
| Compound Name | ethane;1-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]propan-2-one |
|---|---|
| PubChem CID | 177352787 |
| Molecular Formula | C25H31FO2S |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | ethane;1-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]propan-2-one |
| SMILES | CC.CC.CC(=O)CC1=C(C)/C(=C/c2ccc(S(C)=O)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C21H19FO2S.2C2H6/c1-13(23)10-19-14(2)20(18-9-6-16(22)12-21(18)19)11-15-4-7-17(8-5-15)25(3)24;2*1-2/h4-9,11-12H,10H2,1-3H3;2*1-2H3/b20-11-;; |
| InChIKey | TWEXCKYOLNUIJF-ARFXNZMASA-N |
| XLogP | 6.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|