C23H27FOS — CID 144634993
(1E)-3-ethyl-5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methylidene]indene;propane (PubChem CID 144634993) has the molecular formula C23H27FOS and a molecular weight of 370.53 g/mol. Its IUPAC name is (1E)-3-ethyl-5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methylidene]indene;propane.
| Compound Name | (1E)-3-ethyl-5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methylidene]indene;propane |
|---|---|
| PubChem CID | 144634993 |
| Molecular Formula | C23H27FOS |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (1E)-3-ethyl-5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methylidene]indene;propane |
| SMILES | CCC.CCC1=C(C)/C(=C\c2ccc(S(C)=O)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C20H19FOS.C3H8/c1-4-17-13(2)19(18-10-7-15(21)12-20(17)18)11-14-5-8-16(9-6-14)23(3)22;1-3-2/h5-12H,4H2,1-3H3;3H2,1-2H3/b19-11+; |
| InChIKey | SUYWFJGFBXBZSU-YLFUTEQJSA-N |
| XLogP | 6.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|