C23H25FO3SSi — CID 5366714
trimethylsilyl 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate (PubChem CID 5366714) has the molecular formula C23H25FO3SSi and a molecular weight of 428.60 g/mol. Its IUPAC name is trimethylsilyl 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate.
| Compound Name | trimethylsilyl 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
|---|---|
| PubChem CID | 5366714 |
| Molecular Formula | C23H25FO3SSi |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | trimethylsilyl 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
| SMILES | CC1=C(CC(=O)O[Si](C)(C)C)c2cc(F)ccc2/C1=C\c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C23H25FO3SSi/c1-15-20(12-16-6-9-18(10-7-16)28(2)26)19-11-8-17(24)13-22(19)21(15)14-23(25)27-29(3,4)5/h6-13H,14H2,1-5H3/b20-12- |
| InChIKey | OKHGJDWRAXQETR-NDENLUEZSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|