C27H23FN2O6S — CID 68924080
[2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate (PubChem CID 68924080) has the molecular formula C27H23FN2O6S and a molecular weight of 522.55 g/mol. Its IUPAC name is [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate.
| Compound Name | [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
|---|---|
| PubChem CID | 68924080 |
| Molecular Formula | C27H23FN2O6S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
| SMILES | CC1=C(CC(=O)Oc2ccc(CO[N+](=O)[O-])nc2C)c2cc(F)ccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C27H23FN2O6S/c1-16-23(12-18-4-8-21(9-5-18)37(3)34)22-10-6-19(28)13-25(22)24(16)14-27(31)36-26-11-7-20(29-17(26)2)15-35-30(32)33/h4-13H,14-15H2,1-3H3 |
| InChIKey | MPKIXMHTHAKSKO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|