C38H30FN3O13S2 — CID 123971968
(4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxybenzoate (PubChem CID 123971968) has the molecular formula C38H30FN3O13S2 and a molecular weight of 819.80 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxybenzoate.
| Compound Name | (4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxybenzoate |
|---|---|
| PubChem CID | 123971968 |
| Molecular Formula | C38H30FN3O13S2 |
| Molecular Weight | 819.80 g/mol |
| Exact Mass | 819.12 |
| IUPAC Name | (4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxybenzoate |
| SMILES | CC1=C(CC(=O)Oc2ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)Oc3ccc(C(N)=S)cc3)c2)c2cc(F)ccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C38H30FN3O13S2/c1-21-30(15-22-3-11-28(12-4-22)57(2)50)29-13-7-24(39)16-32(29)31(21)19-36(44)52-26-10-14-34(54-35(43)18-27(55-42(48)49)20-51-41(46)47)33(17-26)38(45)53-25-8-5-23(6-9-25)37(40)56/h3-17,27H,18-20H2,1-2H3,(H2,40,56) |
| InChIKey | BHJGHEGQYUOJBE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 226.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.80 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|