C21H19N3O11S — CID 161481348
(4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-(2-oxopropyl)benzoate (PubChem CID 161481348) has the molecular formula C21H19N3O11S and a molecular weight of 521.46 g/mol. Its IUPAC name is (4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-(2-oxopropyl)benzoate.
| Compound Name | (4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-(2-oxopropyl)benzoate |
|---|---|
| PubChem CID | 161481348 |
| Molecular Formula | C21H19N3O11S |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | (4-carbamothioylphenyl) 2-(3,4-dinitrooxybutanoyloxy)-5-(2-oxopropyl)benzoate |
| SMILES | CC(=O)Cc1ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)Oc2ccc(C(N)=S)cc2)c1 |
| InChI | InChI=1S/C21H19N3O11S/c1-12(25)8-13-2-7-18(34-19(26)10-16(35-24(30)31)11-32-23(28)29)17(9-13)21(27)33-15-5-3-14(4-6-15)20(22)36/h2-7,9,16H,8,10-11H2,1H3,(H2,22,36) |
| InChIKey | GYFWJMGEZKFNIB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 200.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|