C21H23N4O11PS2 — CID 90323399
[4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate (PubChem CID 90323399) has the molecular formula C21H23N4O11PS2 and a molecular weight of 602.54 g/mol. Its IUPAC name is [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate.
| Compound Name | [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 90323399 |
| Molecular Formula | C21H23N4O11PS2 |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | [4-[morpholin-4-yl(sulfanyl)phosphinothioyl]phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate |
| SMILES | Nc1ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)Oc2ccc(P(=S)(S)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C21H23N4O11PS2/c22-14-1-6-19(35-20(26)12-16(36-25(30)31)13-33-24(28)29)18(11-14)21(27)34-15-2-4-17(5-3-15)37(38,39)23-7-9-32-10-8-23/h1-6,11,16H,7-10,12-13,22H2,(H,38,39) |
| InChIKey | NSCGOWAYVPDPGA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 195.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|