C21H21N5O8PS2- — CID 140648941
[4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-azido-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 140648941) has the molecular formula C21H21N5O8PS2- and a molecular weight of 566.53 g/mol. Its IUPAC name is [4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-azido-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-azido-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 140648941 |
| Molecular Formula | C21H21N5O8PS2- |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | [4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-azido-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | [N-]=[N+]=Nc1ccc(OC(=O)CCCO[N+](=O)[O-])c(C(=O)Oc2ccc(P(=S)([S-])N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C21H22N5O8PS2/c22-24-23-15-3-8-19(34-20(27)2-1-11-32-26(29)30)18(14-15)21(28)33-16-4-6-17(7-5-16)35(36,37)25-9-12-31-13-10-25/h3-8,14H,1-2,9-13H2,(H,36,37)/p-1 |
| InChIKey | BPQNNODNKZBILH-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 166.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|