C23H24N4O12PS2- — CID 140648945
[4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-acetamido-2-(3,4-dinitrooxybutanoyloxy)benzoate (PubChem CID 140648945) has the molecular formula C23H24N4O12PS2- and a molecular weight of 643.57 g/mol. Its IUPAC name is [4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-acetamido-2-(3,4-dinitrooxybutanoyloxy)benzoate.
| Compound Name | [4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-acetamido-2-(3,4-dinitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 140648945 |
| Molecular Formula | C23H24N4O12PS2- |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | [4-[morpholin-4-yl(sulfido)phosphinothioyl]phenyl] 5-acetamido-2-(3,4-dinitrooxybutanoyloxy)benzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)Oc2ccc(P(=S)([S-])N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H25N4O12PS2/c1-15(28)24-16-2-7-21(38-22(29)13-18(39-27(33)34)14-36-26(31)32)20(12-16)23(30)37-17-3-5-19(6-4-17)40(41,42)25-8-10-35-11-9-25/h2-7,12,18H,8-11,13-14H2,1H3,(H,24,28)(H,41,42)/p-1 |
| InChIKey | BWGQRURXYDQKBO-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 198.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|