C27H33N3O12S2 — CID 144534571
2-methylsulfinylsulfanylethyl 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[4-(2-methylpropyl)phenyl]propanoylamino]benzoate (PubChem CID 144534571) has the molecular formula C27H33N3O12S2 and a molecular weight of 655.70 g/mol. Its IUPAC name is 2-methylsulfinylsulfanylethyl 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[4-(2-methylpropyl)phenyl]propanoylamino]benzoate.
| Compound Name | 2-methylsulfinylsulfanylethyl 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[4-(2-methylpropyl)phenyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 144534571 |
| Molecular Formula | C27H33N3O12S2 |
| Molecular Weight | 655.70 g/mol |
| Exact Mass | 655.15 |
| IUPAC Name | 2-methylsulfinylsulfanylethyl 2-(3,4-dinitrooxybutanoyloxy)-5-[2-[4-(2-methylpropyl)phenyl]propanoylamino]benzoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)Nc2ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)OCCSS(C)=O)c2)cc1 |
| InChI | InChI=1S/C27H33N3O12S2/c1-17(2)13-19-5-7-20(8-6-19)18(3)26(32)28-21-9-10-24(23(14-21)27(33)39-11-12-43-44(4)38)41-25(31)15-22(42-30(36)37)16-40-29(34)35/h5-10,14,17-18,22H,11-13,15-16H2,1-4H3,(H,28,32) |
| InChIKey | DLRMJXATKHEMRQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 203.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|