C20H15N3O10S3 — CID 90323350
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate (PubChem CID 90323350) has the molecular formula C20H15N3O10S3 and a molecular weight of 553.55 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 90323350 |
| Molecular Formula | C20H15N3O10S3 |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 552.99 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-(3,4-dinitrooxybutanoyloxy)benzoate |
| SMILES | Nc1ccc(OC(=O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])c(C(=O)Oc2ccc(-c3cc(=S)ss3)cc2)c1 |
| InChI | InChI=1S/C20H15N3O10S3/c21-12-3-6-16(32-18(24)8-14(33-23(28)29)10-30-22(26)27)15(7-12)20(25)31-13-4-1-11(2-5-13)17-9-19(34)36-35-17/h1-7,9,14H,8,10,21H2 |
| InChIKey | KWJLGYYTDYZCDI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 183.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|