C20H16N2O7S3 — CID 90323304
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-amino-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 90323304) has the molecular formula C20H16N2O7S3 and a molecular weight of 492.56 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-amino-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-amino-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 90323304 |
| Molecular Formula | C20H16N2O7S3 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-amino-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | Nc1ccc(C(=O)Oc2ccc(-c3cc(=S)ss3)cc2)c(OC(=O)CCCO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N2O7S3/c21-13-5-8-15(16(10-13)29-18(23)2-1-9-27-22(25)26)20(24)28-14-6-3-12(4-7-14)17-11-19(30)32-31-17/h3-8,10-11H,1-2,9,21H2 |
| InChIKey | ZYWJQBSNICUXEA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|