C20H17NO6S3 — CID 118597519
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutoxy)benzoate (PubChem CID 118597519) has the molecular formula C20H17NO6S3 and a molecular weight of 463.56 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutoxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutoxy)benzoate |
|---|---|
| PubChem CID | 118597519 |
| Molecular Formula | C20H17NO6S3 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutoxy)benzoate |
| SMILES | O=C(Oc1ccc(-c2cc(=S)ss2)cc1)c1ccccc1OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C20H17NO6S3/c22-20(27-15-9-7-14(8-10-15)18-13-19(28)30-29-18)16-5-1-2-6-17(16)25-11-3-4-12-26-21(23)24/h1-2,5-10,13H,3-4,11-12H2 |
| InChIKey | WFHQNCOUOOWSPX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|