C20H19NO2S3 — CID 46906239
N-phenyl-5-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]pentanamide (PubChem CID 46906239) has the molecular formula C20H19NO2S3 and a molecular weight of 401.58 g/mol. Its IUPAC name is N-phenyl-5-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]pentanamide.
| Compound Name | N-phenyl-5-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]pentanamide |
|---|---|
| PubChem CID | 46906239 |
| Molecular Formula | C20H19NO2S3 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-phenyl-5-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]pentanamide |
| SMILES | O=C(CCCCOc1ccc(-c2cc(=S)ss2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C20H19NO2S3/c22-19(21-16-6-2-1-3-7-16)8-4-5-13-23-17-11-9-15(10-12-17)18-14-20(24)26-25-18/h1-3,6-7,9-12,14H,4-5,8,13H2,(H,21,22) |
| InChIKey | BZZPUIZWXRTGKA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|