C21H20N2O4S3 — CID 132578450
4-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]butyl 2-(pyridine-3-carbonylamino)acetate (PubChem CID 132578450) has the molecular formula C21H20N2O4S3 and a molecular weight of 460.60 g/mol. Its IUPAC name is 4-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]butyl 2-(pyridine-3-carbonylamino)acetate.
| Compound Name | 4-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]butyl 2-(pyridine-3-carbonylamino)acetate |
|---|---|
| PubChem CID | 132578450 |
| Molecular Formula | C21H20N2O4S3 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]butyl 2-(pyridine-3-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1cccnc1)OCCCCOc1ccc(-c2cc(=S)ss2)cc1 |
| InChI | InChI=1S/C21H20N2O4S3/c24-19(14-23-21(25)16-4-3-9-22-13-16)27-11-2-1-10-26-17-7-5-15(6-8-17)18-12-20(28)30-29-18/h3-9,12-13H,1-2,10-11,14H2,(H,23,25) |
| InChIKey | OOKDQAKUJSAVQW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|