C14H12F2N2O2 — CID 110481998
N-[2-(3,5-difluorophenoxy)ethyl]pyridine-3-carboxamide (PubChem CID 110481998) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenoxy)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(3,5-difluorophenoxy)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110481998 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[2-(3,5-difluorophenoxy)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1cc(F)cc(F)c1)c1cccnc1 |
| InChI | InChI=1S/C14H12F2N2O2/c15-11-6-12(16)8-13(7-11)20-5-4-18-14(19)10-2-1-3-17-9-10/h1-3,6-9H,4-5H2,(H,18,19) |
| InChIKey | NYGVZGMQDGKUIE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|