C8H10ClN3O4 — CID 3017561
2-(pyridine-3-carbonylamino)ethyl nitrate;hydrochloride (PubChem CID 3017561) has the molecular formula C8H10ClN3O4 and a molecular weight of 247.64 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)ethyl nitrate;hydrochloride.
| Compound Name | 2-(pyridine-3-carbonylamino)ethyl nitrate;hydrochloride |
|---|---|
| PubChem CID | 3017561 |
| Molecular Formula | C8H10ClN3O4 |
| Molecular Weight | 247.64 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)ethyl nitrate;hydrochloride |
| SMILES | Cl.O=C(NCCO[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C8H9N3O4.ClH/c12-8(7-2-1-3-9-6-7)10-4-5-15-11(13)14;/h1-3,6H,4-5H2,(H,10,12);1H |
| InChIKey | JAOVSCYJFMHGEJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.64 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|