C10H13N3O4S2 — CID 11558535
2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl nitrate (PubChem CID 11558535) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl nitrate.
| Compound Name | 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl nitrate |
|---|---|
| PubChem CID | 11558535 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethyl nitrate |
| SMILES | O=C(NCCSSCCO[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C10H13N3O4S2/c14-10(9-2-1-3-11-8-9)12-4-6-18-19-7-5-17-13(15)16/h1-3,8H,4-7H2,(H,12,14) |
| InChIKey | YWZAHDWAIFWMKK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|