About 2-benzamidoethyl nitrate
2-benzamidoethyl nitrate (PubChem CID 10536408) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-benzamidoethyl nitrate.
Molecular Properties
| Compound Name | 2-benzamidoethyl nitrate |
| PubChem CID | 10536408 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-benzamidoethyl nitrate |
| SMILES | O=C(NCCO[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H10N2O4/c12-9(8-4-2-1-3-5-8)10-6-7-15-11(13)14/h1-5H,6-7H2,(H,10,12) |
| InChIKey | GZDAQQXENFCXKS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzamidoethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidoethyl nitrate?
The IUPAC name of 2-benzamidoethyl nitrate (CID 10536408) is 2-benzamidoethyl nitrate.
What is the SMILES notation for 2-benzamidoethyl nitrate?
The canonical SMILES for 2-benzamidoethyl nitrate is O=C(NCCO[N+](=O)[O-])c1ccccc1.
What is the InChIKey of 2-benzamidoethyl nitrate?
The InChIKey is GZDAQQXENFCXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4/c12-9(8-4-2-1-3-5-8)10-6-7-15-11(13)14/h1-5H,6-7H2,(H,10,12).
What are the key properties of 2-benzamidoethyl nitrate?
2-benzamidoethyl nitrate has a molecular weight of 210.19 g/mol, XLogP of 0.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidoethyl nitrate is sourced from PubChem (CID 10536408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).