C22H33N3O5S2 — CID 54588575
ethyl 2-[1-[[2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetate (PubChem CID 54588575) has the molecular formula C22H33N3O5S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is ethyl 2-[1-[[2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-[[2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 54588575 |
| Molecular Formula | C22H33N3O5S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | ethyl 2-[1-[[2-[2-(pyridine-3-carbonylamino)ethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(CNC(=O)OCCSSCCNC(=O)c2cccnc2)CCCCC1 |
| InChI | InChI=1S/C22H33N3O5S2/c1-2-29-19(26)15-22(8-4-3-5-9-22)17-25-21(28)30-12-14-32-31-13-11-24-20(27)18-7-6-10-23-16-18/h6-7,10,16H,2-5,8-9,11-15,17H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | IUQLKKLOXLUJOV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|