C16H29NO4S2 — CID 58492937
methyl 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]acetate (PubChem CID 58492937) has the molecular formula C16H29NO4S2 and a molecular weight of 363.55 g/mol. Its IUPAC name is methyl 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]acetate.
| Compound Name | methyl 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]acetate |
|---|---|
| PubChem CID | 58492937 |
| Molecular Formula | C16H29NO4S2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]acetate |
| SMILES | CCCC1(CNC(=O)OCCSSCC(=O)OC)CCCCC1 |
| InChI | InChI=1S/C16H29NO4S2/c1-3-7-16(8-5-4-6-9-16)13-17-15(19)21-10-11-22-23-12-14(18)20-2/h3-13H2,1-2H3,(H,17,19) |
| InChIKey | NCATXEMOUUMLGN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|