C18H31NO6 — CID 91170638
2-[1-[(4-butanoyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid (PubChem CID 91170638) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[1-[(4-butanoyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[(4-butanoyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 91170638 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-[1-[(4-butanoyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid |
| SMILES | CCCC(=O)OCCCCOC(=O)NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H31NO6/c1-2-8-16(22)24-11-6-7-12-25-17(23)19-14-18(13-15(20)21)9-4-3-5-10-18/h2-14H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | QEUAPQGCDJOBTB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|