C17H29NO6 — CID 10132201
2-[1-[(1-pentanoyloxyethoxycarbonylamino)methyl]cyclohexyl]acetic acid (PubChem CID 10132201) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[1-[(1-pentanoyloxyethoxycarbonylamino)methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[(1-pentanoyloxyethoxycarbonylamino)methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 10132201 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[1-[(1-pentanoyloxyethoxycarbonylamino)methyl]cyclohexyl]acetic acid |
| SMILES | CCCCC(=O)OC(C)OC(=O)NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H29NO6/c1-3-4-8-15(21)23-13(2)24-16(22)18-12-17(11-14(19)20)9-6-5-7-10-17/h13H,3-12H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | VIECLRITOCRGPR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|