C19H33NO9S — CID 90206103
3-[1-[2-[1-(2-butoxy-2-oxoethyl)cyclopentyl]acetyl]oxyethoxycarbonylamino]propane-1-sulfonic acid (PubChem CID 90206103) has the molecular formula C19H33NO9S and a molecular weight of 451.54 g/mol. Its IUPAC name is 3-[1-[2-[1-(2-butoxy-2-oxoethyl)cyclopentyl]acetyl]oxyethoxycarbonylamino]propane-1-sulfonic acid.
| Compound Name | 3-[1-[2-[1-(2-butoxy-2-oxoethyl)cyclopentyl]acetyl]oxyethoxycarbonylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90206103 |
| Molecular Formula | C19H33NO9S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-[1-[2-[1-(2-butoxy-2-oxoethyl)cyclopentyl]acetyl]oxyethoxycarbonylamino]propane-1-sulfonic acid |
| SMILES | CCCCOC(=O)CC1(CC(=O)OC(C)OC(=O)NCCCS(=O)(=O)O)CCCC1 |
| InChI | InChI=1S/C19H33NO9S/c1-3-4-11-27-16(21)13-19(8-5-6-9-19)14-17(22)28-15(2)29-18(23)20-10-7-12-30(24,25)26/h15H,3-14H2,1-2H3,(H,20,23)(H,24,25,26) |
| InChIKey | ZOZDLEDTIYBLEY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|