About [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate
[(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate (PubChem CID 129383287) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate.
Molecular Properties
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate |
| PubChem CID | 129383287 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate |
| SMILES | CCCCCCCCCCNC(=O)O[C@H](C)C(N)=O |
| InChI | InChI=1S/C14H28N2O3/c1-3-4-5-6-7-8-9-10-11-16-14(18)19-12(2)13(15)17/h12H,3-11H2,1-2H3,(H2,15,17)(H,16,18)/t12-/m1/s1 |
| InChIKey | HEAMLJUWZOVWRF-GFCCVEGCSA-N |
| XLogP | 2.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate?
The IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate (CID 129383287) is [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate.
What is the SMILES notation for [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate?
The canonical SMILES for [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate is CCCCCCCCCCNC(=O)O[C@H](C)C(N)=O.
What is the InChIKey of [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate?
The InChIKey is HEAMLJUWZOVWRF-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-3-4-5-6-7-8-9-10-11-16-14(18)19-12(2)13(15)17/h12H,3-11H2,1-2H3,(H2,15,17)(H,16,18)/t12-/m1/s1.
What are the key properties of [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate?
[(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate has a molecular weight of 272.39 g/mol, XLogP of 2.73, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-amino-1-oxopropan-2-yl] N-decylcarbamate is sourced from PubChem (CID 129383287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).