C20H32N2O12 — CID 170239407
2-[2-[6-[[1-(1-carboxyethoxy)-1-oxopropan-2-yl]oxycarbonylamino]hexylcarbamoyloxy]propanoyloxy]propanoic acid (PubChem CID 170239407) has the molecular formula C20H32N2O12 and a molecular weight of 492.48 g/mol. Its IUPAC name is 2-[2-[6-[[1-(1-carboxyethoxy)-1-oxopropan-2-yl]oxycarbonylamino]hexylcarbamoyloxy]propanoyloxy]propanoic acid.
| Compound Name | 2-[2-[6-[[1-(1-carboxyethoxy)-1-oxopropan-2-yl]oxycarbonylamino]hexylcarbamoyloxy]propanoyloxy]propanoic acid |
|---|---|
| PubChem CID | 170239407 |
| Molecular Formula | C20H32N2O12 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-[2-[6-[[1-(1-carboxyethoxy)-1-oxopropan-2-yl]oxycarbonylamino]hexylcarbamoyloxy]propanoyloxy]propanoic acid |
| SMILES | CC(OC(=O)C(C)OC(=O)NCCCCCCNC(=O)OC(C)C(=O)OC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N2O12/c1-11(15(23)24)31-17(27)13(3)33-19(29)21-9-7-5-6-8-10-22-20(30)34-14(4)18(28)32-12(2)16(25)26/h11-14H,5-10H2,1-4H3,(H,21,29)(H,22,30)(H,23,24)(H,25,26) |
| InChIKey | MTLOVWLTVPUGMV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 203.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|