C17H36N2O4 — CID 173269465
N,N-dimethylmethanamine;3-(nonylcarbamoyloxy)butanoic acid (PubChem CID 173269465) has the molecular formula C17H36N2O4 and a molecular weight of 332.49 g/mol. Its IUPAC name is N,N-dimethylmethanamine;3-(nonylcarbamoyloxy)butanoic acid.
| Compound Name | N,N-dimethylmethanamine;3-(nonylcarbamoyloxy)butanoic acid |
|---|---|
| PubChem CID | 173269465 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | N,N-dimethylmethanamine;3-(nonylcarbamoyloxy)butanoic acid |
| SMILES | CCCCCCCCCNC(=O)OC(C)CC(=O)O.CN(C)C |
| InChI | InChI=1S/C14H27NO4.C3H9N/c1-3-4-5-6-7-8-9-10-15-14(18)19-12(2)11-13(16)17;1-4(2)3/h12H,3-11H2,1-2H3,(H,15,18)(H,16,17);1-3H3 |
| InChIKey | IZEAHGNHBSZYET-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|