About 1-(methylamino)propan-2-yl N-butylcarbamate
1-(methylamino)propan-2-yl N-butylcarbamate (PubChem CID 79338018) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(methylamino)propan-2-yl N-butylcarbamate.
Molecular Properties
| Compound Name | 1-(methylamino)propan-2-yl N-butylcarbamate |
| PubChem CID | 79338018 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1-(methylamino)propan-2-yl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC(C)CNC |
| InChI | InChI=1S/C9H20N2O2/c1-4-5-6-11-9(12)13-8(2)7-10-3/h8,10H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | CEVYZFYOXUKLIE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylamino)propan-2-yl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)propan-2-yl N-butylcarbamate?
The IUPAC name of 1-(methylamino)propan-2-yl N-butylcarbamate (CID 79338018) is 1-(methylamino)propan-2-yl N-butylcarbamate.
What is the SMILES notation for 1-(methylamino)propan-2-yl N-butylcarbamate?
The canonical SMILES for 1-(methylamino)propan-2-yl N-butylcarbamate is CCCCNC(=O)OC(C)CNC.
What is the InChIKey of 1-(methylamino)propan-2-yl N-butylcarbamate?
The InChIKey is CEVYZFYOXUKLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-4-5-6-11-9(12)13-8(2)7-10-3/h8,10H,4-7H2,1-3H3,(H,11,12).
What are the key properties of 1-(methylamino)propan-2-yl N-butylcarbamate?
1-(methylamino)propan-2-yl N-butylcarbamate has a molecular weight of 188.27 g/mol, XLogP of 1.12, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)propan-2-yl N-butylcarbamate is sourced from PubChem (CID 79338018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).