C11H24N2O2 — CID 20721719
butan-2-yl N-[4-(dimethylamino)butyl]carbamate (PubChem CID 20721719) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is butan-2-yl N-[4-(dimethylamino)butyl]carbamate.
| Compound Name | butan-2-yl N-[4-(dimethylamino)butyl]carbamate |
|---|---|
| PubChem CID | 20721719 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | butan-2-yl N-[4-(dimethylamino)butyl]carbamate |
| SMILES | CCC(C)OC(=O)NCCCCN(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-5-10(2)15-11(14)12-8-6-7-9-13(3)4/h10H,5-9H2,1-4H3,(H,12,14) |
| InChIKey | MCFDRMKUTNWURW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|