C50H94N4O8 — CID 176951923
[2,3-bis[4-(dimethylamino)butylcarbamoyloxy]-4-[(Z)-hexadec-9-enoyl]oxybutyl] (Z)-hexadec-9-enoate (PubChem CID 176951923) has the molecular formula C50H94N4O8 and a molecular weight of 879.32 g/mol. Its IUPAC name is [2,3-bis[4-(dimethylamino)butylcarbamoyloxy]-4-[(Z)-hexadec-9-enoyl]oxybutyl] (Z)-hexadec-9-enoate.
| Compound Name | [2,3-bis[4-(dimethylamino)butylcarbamoyloxy]-4-[(Z)-hexadec-9-enoyl]oxybutyl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 176951923 |
| Molecular Formula | C50H94N4O8 |
| Molecular Weight | 879.32 g/mol |
| Exact Mass | 878.71 |
| IUPAC Name | [2,3-bis[4-(dimethylamino)butylcarbamoyloxy]-4-[(Z)-hexadec-9-enoyl]oxybutyl] (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)NCCCCN(C)C)C(COC(=O)CCCCCCC/C=C\CCCCCC)OC(=O)NCCCCN(C)C |
| InChI | InChI=1S/C50H94N4O8/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-37-47(55)59-43-45(61-49(57)51-39-33-35-41-53(3)4)46(62-50(58)52-40-34-36-42-54(5)6)44-60-48(56)38-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h17-20,45-46H,7-16,21-44H2,1-6H3,(H,51,57)(H,52,58)/b19-17-,20-18- |
| InChIKey | UJBJDRLYOVYOAD-CLFAGFIQSA-N |
| XLogP | 11.46 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.32 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|