C45H84N2O7 — CID 86751865
[2-[2-[2-hydroxyethyl(methyl)amino]ethylcarbamoyloxy]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 86751865) has the molecular formula C45H84N2O7 and a molecular weight of 765.17 g/mol. Its IUPAC name is [2-[2-[2-hydroxyethyl(methyl)amino]ethylcarbamoyloxy]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[2-[2-hydroxyethyl(methyl)amino]ethylcarbamoyloxy]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 86751865 |
| Molecular Formula | C45H84N2O7 |
| Molecular Weight | 765.17 g/mol |
| Exact Mass | 764.63 |
| IUPAC Name | [2-[2-[2-hydroxyethyl(methyl)amino]ethylcarbamoyloxy]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)NCCN(C)CCO |
| InChI | InChI=1S/C45H84N2O7/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-43(49)52-40-42(54-45(51)46-36-37-47(3)38-39-48)41-53-44(50)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,42,48H,4-17,22-41H2,1-3H3,(H,46,51)/b20-18-,21-19- |
| InChIKey | NXMBYUYBAXRDJP-AUYXYSRISA-N |
| XLogP | 11.17 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.17 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|