C114H206O12 — CID 75124258
[(2S,3R,4R,5R)-2,3,4,5,6-pentakis[[(Z)-octadec-9-enoyl]oxy]hexyl] (Z)-octadec-9-enoate (PubChem CID 75124258) has the molecular formula C114H206O12 and a molecular weight of 1768.89 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4,5,6-pentakis[[(Z)-octadec-9-enoyl]oxy]hexyl] (Z)-octadec-9-enoate.
| Compound Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentakis[[(Z)-octadec-9-enoyl]oxy]hexyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 75124258 |
| Molecular Formula | C114H206O12 |
| Molecular Weight | 1768.89 g/mol |
| Exact Mass | 1767.55 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentakis[[(Z)-octadec-9-enoyl]oxy]hexyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C114H206O12/c1-7-13-19-25-31-37-43-49-55-61-67-73-79-85-91-97-107(115)121-103-105(123-109(117)99-93-87-81-75-69-63-57-51-45-39-33-27-21-15-9-3)113(125-111(119)101-95-89-83-77-71-65-59-53-47-41-35-29-23-17-11-5)114(126-112(120)102-96-90-84-78-72-66-60-54-48-42-36-30-24-18-12-6)106(124-110(118)100-94-88-82-76-70-64-58-52-46-40-34-28-22-16-10-4)104-122-108(116)98-92-86-80-74-68-62-56-50-44-38-32-26-20-14-8-2/h49-60,105-106,113-114H,7-48,61-104H2,1-6H3/b55-49-,56-50-,57-51-,58-52-,59-53-,60-54-/t105-,106+,113-,114-/m1/s1 |
| InChIKey | RKZXQQPEDGMHBJ-LIGJGSPWSA-N |
| XLogP | 35.94 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 101 |
| Heavy Atoms | 126 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1768.89 |
| LogP ≤ 5 | 35.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|