C74H138N4O4 — CID 123563097
11-[10-[3-(11-dec-4-enyldocosa-6,15-dien-10-yloxycarbonylamino)propyl-methylamino]dec-4-enyl]docosa-6,15-dien-10-yl N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 123563097) has the molecular formula C74H138N4O4 and a molecular weight of 1147.94 g/mol. Its IUPAC name is 11-[10-[3-(11-dec-4-enyldocosa-6,15-dien-10-yloxycarbonylamino)propyl-methylamino]dec-4-enyl]docosa-6,15-dien-10-yl N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | 11-[10-[3-(11-dec-4-enyldocosa-6,15-dien-10-yloxycarbonylamino)propyl-methylamino]dec-4-enyl]docosa-6,15-dien-10-yl N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 123563097 |
| Molecular Formula | C74H138N4O4 |
| Molecular Weight | 1147.94 g/mol |
| Exact Mass | 1147.07 |
| IUPAC Name | 11-[10-[3-(11-dec-4-enyldocosa-6,15-dien-10-yloxycarbonylamino)propyl-methylamino]dec-4-enyl]docosa-6,15-dien-10-yl N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | CCCCCC=CCCCC(CCCC=CCCCCCC)C(CCC=CCCCCC)OC(=O)NCCCN(C)CCCCCC=CCCCC(CCCC=CCCCCCC)C(CCC=CCCCCC)OC(=O)NCCN(C)C |
| InChI | InChI=1S/C74H138N4O4/c1-9-14-19-24-29-32-39-44-51-59-69(58-50-43-38-31-26-21-16-11-3)71(62-54-47-36-27-22-17-12-4)81-73(79)75-64-57-67-78(8)66-56-49-42-35-34-41-46-53-61-70(60-52-45-40-33-30-25-20-15-10-2)72(63-55-48-37-28-23-18-13-5)82-74(80)76-65-68-77(6)7/h31-34,36-41,47-48,69-72H,9-30,35,42-46,49-68H2,1-8H3,(H,75,79)(H,76,80) |
| InChIKey | LFXXXHYJKKMABG-UHFFFAOYSA-N |
| XLogP | 22.11 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 61 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.94 |
| LogP ≤ 5 | 22.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|