C37H66N2O2 — CID 166796300
[(6Z,13Z,16Z)-12-[(4Z,8E)-deca-4,8-dienyl]docosa-6,13,16-trien-11-yl] N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 166796300) has the molecular formula C37H66N2O2 and a molecular weight of 570.95 g/mol. Its IUPAC name is [(6Z,13Z,16Z)-12-[(4Z,8E)-deca-4,8-dienyl]docosa-6,13,16-trien-11-yl] N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | [(6Z,13Z,16Z)-12-[(4Z,8E)-deca-4,8-dienyl]docosa-6,13,16-trien-11-yl] N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 166796300 |
| Molecular Formula | C37H66N2O2 |
| Molecular Weight | 570.95 g/mol |
| Exact Mass | 570.51 |
| IUPAC Name | [(6Z,13Z,16Z)-12-[(4Z,8E)-deca-4,8-dienyl]docosa-6,13,16-trien-11-yl] N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | C/C=C/CC/C=C\CCCC(/C=C\C/C=C\CCCCC)C(CCC/C=C\CCCCC)OC(=O)NCCN(C)C |
| InChI | InChI=1S/C37H66N2O2/c1-6-9-12-15-18-21-24-27-30-35(31-28-25-22-19-16-13-10-7-2)36(41-37(40)38-33-34-39(4)5)32-29-26-23-20-17-14-11-8-3/h6,9,18-23,28,31,35-36H,7-8,10-17,24-27,29-30,32-34H2,1-5H3,(H,38,40)/b9-6+,21-18-,22-19-,23-20-,31-28- |
| InChIKey | BTYVDCBBKDPMLA-KFAIUNKESA-N |
| XLogP | 10.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.95 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|