C42H80N2O — CID 130459049
3-(dimethylamino)-N-[(11Z,14Z)-2-[(Z)-heptadec-9-enyl]icosa-11,14-dienyl]propanamide (PubChem CID 130459049) has the molecular formula C42H80N2O and a molecular weight of 629.12 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(11Z,14Z)-2-[(Z)-heptadec-9-enyl]icosa-11,14-dienyl]propanamide.
| Compound Name | 3-(dimethylamino)-N-[(11Z,14Z)-2-[(Z)-heptadec-9-enyl]icosa-11,14-dienyl]propanamide |
|---|---|
| PubChem CID | 130459049 |
| Molecular Formula | C42H80N2O |
| Molecular Weight | 629.12 g/mol |
| Exact Mass | 628.63 |
| IUPAC Name | 3-(dimethylamino)-N-[(11Z,14Z)-2-[(Z)-heptadec-9-enyl]icosa-11,14-dienyl]propanamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCC)CNC(=O)CCN(C)C |
| InChI | InChI=1S/C42H80N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(40-43-42(45)38-39-44(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13,15,18-21,41H,5-12,14,16-17,22-40H2,1-4H3,(H,43,45)/b15-13-,20-18-,21-19- |
| InChIKey | HBCAYLXYYQGQLV-MXLPAPOISA-N |
| XLogP | 12.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.12 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|