C44H84N2O2 — CID 143992108
3-(dimethylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate;molecular hydrogen (PubChem CID 143992108) has the molecular formula C44H84N2O2 and a molecular weight of 673.17 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate;molecular hydrogen.
| Compound Name | 3-(dimethylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 143992108 |
| Molecular Formula | C44H84N2O2 |
| Molecular Weight | 673.17 g/mol |
| Exact Mass | 672.65 |
| IUPAC Name | 3-(dimethylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate;molecular hydrogen |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CNC(=O)OCCCN(C)C.[H][H] |
| InChI | InChI=1S/C44H82N2O2.H2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-43(42-45-44(47)48-41-37-40-46(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h13-16,19-22,43H,5-12,17-18,23-42H2,1-4H3,(H,45,47);1H/b15-13-,16-14-,21-19-,22-20-; |
| InChIKey | ZTQRVHPFXABNFO-KSLMYTHLSA-N |
| XLogP | 13.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.17 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|