C43H80N2O2 — CID 130350648
3-(methylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate (PubChem CID 130350648) has the molecular formula C43H80N2O2 and a molecular weight of 657.12 g/mol. Its IUPAC name is 3-(methylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate.
| Compound Name | 3-(methylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate |
|---|---|
| PubChem CID | 130350648 |
| Molecular Formula | C43H80N2O2 |
| Molecular Weight | 657.12 g/mol |
| Exact Mass | 656.62 |
| IUPAC Name | 3-(methylamino)propyl N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CNC(=O)OCCCNC |
| InChI | InChI=1S/C43H80N2O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-42(41-45-43(46)47-40-36-39-44-3)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42,44H,4-11,16-17,22-41H2,1-3H3,(H,45,46)/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | VNBACPRUDUVHNK-QYCRHRGJSA-N |
| XLogP | 13.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.12 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|