C39H71NO2 — CID 175092094
[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] carbamate (PubChem CID 175092094) has the molecular formula C39H71NO2 and a molecular weight of 586.00 g/mol. Its IUPAC name is [(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] carbamate.
| Compound Name | [(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] carbamate |
|---|---|
| PubChem CID | 175092094 |
| Molecular Formula | C39H71NO2 |
| Molecular Weight | 586.00 g/mol |
| Exact Mass | 585.55 |
| IUPAC Name | [(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)COC(N)=O |
| InChI | InChI=1S/C39H71NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(37-42-39(40)41)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38H,3-10,15-16,21-37H2,1-2H3,(H2,40,41)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | UKJDWWLSJXMIIT-MAZCIEHSSA-N |
| XLogP | 13.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.00 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|