C26H48O — CID 173398960
(9Z,12Z)-19-ethyltetracosa-9,12-dienal (PubChem CID 173398960) has the molecular formula C26H48O and a molecular weight of 376.67 g/mol. Its IUPAC name is (9Z,12Z)-19-ethyltetracosa-9,12-dienal.
| Compound Name | (9Z,12Z)-19-ethyltetracosa-9,12-dienal |
|---|---|
| PubChem CID | 173398960 |
| Molecular Formula | C26H48O |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.37 |
| IUPAC Name | (9Z,12Z)-19-ethyltetracosa-9,12-dienal |
| SMILES | CCCCCC(CC)CCCCC/C=C\C/C=C\CCCCCCCC=O |
| InChI | InChI=1S/C26H48O/c1-3-5-20-23-26(4-2)24-21-18-16-14-12-10-8-6-7-9-11-13-15-17-19-22-25-27/h6-7,10,12,25-26H,3-5,8-9,11,13-24H2,1-2H3/b7-6-,12-10- |
| InChIKey | CADWIMRTQUKADR-CEHXRRPISA-N |
| XLogP | 8.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|