C33H63NO — CID 146462803
(20Z,23Z)-10-[2-(dimethylamino)ethyl]nonacosa-20,23-dienal (PubChem CID 146462803) has the molecular formula C33H63NO and a molecular weight of 489.87 g/mol. Its IUPAC name is (20Z,23Z)-10-[2-(dimethylamino)ethyl]nonacosa-20,23-dienal.
| Compound Name | (20Z,23Z)-10-[2-(dimethylamino)ethyl]nonacosa-20,23-dienal |
|---|---|
| PubChem CID | 146462803 |
| Molecular Formula | C33H63NO |
| Molecular Weight | 489.87 g/mol |
| Exact Mass | 489.49 |
| IUPAC Name | (20Z,23Z)-10-[2-(dimethylamino)ethyl]nonacosa-20,23-dienal |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC=O)CCN(C)C |
| InChI | InChI=1S/C33H63NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25-28-33(30-31-34(2)3)29-26-23-20-18-21-24-27-32-35/h8-9,11-12,32-33H,4-7,10,13-31H2,1-3H3/b9-8-,12-11- |
| InChIKey | PCMXAJDRQMVBKQ-MURFETPASA-N |
| XLogP | 10.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.87 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|