C23H41NO4 — CID 46912769
4-[[(9Z,12Z)-octadeca-9,12-dienoxy]carbonylamino]butanoic acid (PubChem CID 46912769) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is 4-[[(9Z,12Z)-octadeca-9,12-dienoxy]carbonylamino]butanoic acid.
| Compound Name | 4-[[(9Z,12Z)-octadeca-9,12-dienoxy]carbonylamino]butanoic acid |
|---|---|
| PubChem CID | 46912769 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | 4-[[(9Z,12Z)-octadeca-9,12-dienoxy]carbonylamino]butanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C23H41NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-28-23(27)24-20-18-19-22(25)26/h6-7,9-10H,2-5,8,11-21H2,1H3,(H,24,27)(H,25,26)/b7-6-,10-9- |
| InChIKey | LIKVJAABWTZNGL-HZJYTTRNSA-N |
| XLogP | 6.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|