C42H78N2O — CID 139380852
3-(methylamino)-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]propanamide (PubChem CID 139380852) has the molecular formula C42H78N2O and a molecular weight of 627.10 g/mol. Its IUPAC name is 3-(methylamino)-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]propanamide.
| Compound Name | 3-(methylamino)-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]propanamide |
|---|---|
| PubChem CID | 139380852 |
| Molecular Formula | C42H78N2O |
| Molecular Weight | 627.10 g/mol |
| Exact Mass | 626.61 |
| IUPAC Name | 3-(methylamino)-N-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]propanamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CNC(=O)CCNC |
| InChI | InChI=1S/C42H78N2O/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(40-44-42(45)38-39-43-3)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41,43H,4-11,16-17,22-40H2,1-3H3,(H,44,45)/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | KZWWFXBIOYXZIS-QYCRHRGJSA-N |
| XLogP | 12.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.10 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|