C42H77NO2 — CID 139503106
[(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(methylamino)butanoate (PubChem CID 139503106) has the molecular formula C42H77NO2 and a molecular weight of 628.08 g/mol. Its IUPAC name is [(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(methylamino)butanoate.
| Compound Name | [(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(methylamino)butanoate |
|---|---|
| PubChem CID | 139503106 |
| Molecular Formula | C42H77NO2 |
| Molecular Weight | 628.08 g/mol |
| Exact Mass | 627.60 |
| IUPAC Name | [(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(methylamino)butanoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCC(CCCCCCCC/C=C/C/C=C/CCCCC)OC(=O)CCCNC |
| InChI | InChI=1S/C42H77NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-41(45-42(44)39-36-40-43-3)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41,43H,4-11,16-17,22-40H2,1-3H3/b14-12+,15-13+,20-18+,21-19+ |
| InChIKey | HGFPXLQBXYBNQX-IURJCLCNSA-N |
| XLogP | 13.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.08 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|