C46H86N4O2 — CID 164813974
3-[2-(dimethylamino)ethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl]amino]-N-[(9Z,12Z)-octadeca-9,12-dienyl]propanamide (PubChem CID 164813974) has the molecular formula C46H86N4O2 and a molecular weight of 727.22 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl]amino]-N-[(9Z,12Z)-octadeca-9,12-dienyl]propanamide.
| Compound Name | 3-[2-(dimethylamino)ethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl]amino]-N-[(9Z,12Z)-octadeca-9,12-dienyl]propanamide |
|---|---|
| PubChem CID | 164813974 |
| Molecular Formula | C46H86N4O2 |
| Molecular Weight | 727.22 g/mol |
| Exact Mass | 726.68 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]-3-oxopropyl]amino]-N-[(9Z,12Z)-octadeca-9,12-dienyl]propanamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCNC(=O)CCN(CCC(=O)NCCCCCCCC/C=C\C/C=C\CCCCC)CCN(C)C |
| InChI | InChI=1S/C46H86N4O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-47-45(51)37-41-50(44-43-49(3)4)42-38-46(52)48-40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-44H2,1-4H3,(H,47,51)(H,48,52)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | KMZZKIZZEYBMAI-KWXKLSQISA-N |
| XLogP | 11.49 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.22 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|