C37H65NO2 — CID 166796278
[(6Z,15Z,18E)-11-[(Z)-dec-4-enyl]henicosa-6,15,18-trien-10-yl] (E)-4-(dimethylamino)but-2-enoate (PubChem CID 166796278) has the molecular formula C37H65NO2 and a molecular weight of 555.93 g/mol. Its IUPAC name is [(6Z,15Z,18E)-11-[(Z)-dec-4-enyl]henicosa-6,15,18-trien-10-yl] (E)-4-(dimethylamino)but-2-enoate.
| Compound Name | [(6Z,15Z,18E)-11-[(Z)-dec-4-enyl]henicosa-6,15,18-trien-10-yl] (E)-4-(dimethylamino)but-2-enoate |
|---|---|
| PubChem CID | 166796278 |
| Molecular Formula | C37H65NO2 |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 555.50 |
| IUPAC Name | [(6Z,15Z,18E)-11-[(Z)-dec-4-enyl]henicosa-6,15,18-trien-10-yl] (E)-4-(dimethylamino)but-2-enoate |
| SMILES | CC/C=C/C/C=C\CCCC(CCC/C=C\CCCCC)C(CC/C=C\CCCCC)OC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C37H65NO2/c1-6-9-12-15-18-21-23-26-30-35(31-27-24-22-19-16-13-10-7-2)36(32-28-25-20-17-14-11-8-3)40-37(39)33-29-34-38(4)5/h9,12,18-22,25,29,33,35-36H,6-8,10-11,13-17,23-24,26-28,30-32,34H2,1-5H3/b12-9+,21-18-,22-19-,25-20-,33-29+ |
| InChIKey | FZRSOWPOIJXGIY-OAAPECGNSA-N |
| XLogP | 10.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|