C26H46O3 — CID 134500817
(3-heptyl-1-oxopentadeca-9,12-dien-2-yl) 2-methylpropanoate (PubChem CID 134500817) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is (3-heptyl-1-oxopentadeca-9,12-dien-2-yl) 2-methylpropanoate.
| Compound Name | (3-heptyl-1-oxopentadeca-9,12-dien-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 134500817 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | (3-heptyl-1-oxopentadeca-9,12-dien-2-yl) 2-methylpropanoate |
| SMILES | CCC=CCC=CCCCCCC(CCCCCCC)C(C=O)OC(=O)C(C)C |
| InChI | InChI=1S/C26H46O3/c1-5-7-9-11-12-13-14-15-17-19-21-24(20-18-16-10-8-6-2)25(22-27)29-26(28)23(3)4/h7,9,12-13,22-25H,5-6,8,10-11,14-21H2,1-4H3 |
| InChIKey | SWBKTUVBNKQGTO-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|