C49H90O2 — CID 91084030
3,4-dimethylpentyl 2,3-dimethyl-4-octadeca-9,12-dienyldocosa-13,16-dienoate (PubChem CID 91084030) has the molecular formula C49H90O2 and a molecular weight of 711.26 g/mol. Its IUPAC name is 3,4-dimethylpentyl 2,3-dimethyl-4-octadeca-9,12-dienyldocosa-13,16-dienoate.
| Compound Name | 3,4-dimethylpentyl 2,3-dimethyl-4-octadeca-9,12-dienyldocosa-13,16-dienoate |
|---|---|
| PubChem CID | 91084030 |
| Molecular Formula | C49H90O2 |
| Molecular Weight | 711.26 g/mol |
| Exact Mass | 710.69 |
| IUPAC Name | 3,4-dimethylpentyl 2,3-dimethyl-4-octadeca-9,12-dienyldocosa-13,16-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CCC=CCCCCC)C(C)C(C)C(=O)OCCC(C)C(C)C |
| InChI | InChI=1S/C49H90O2/c1-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-48(46(6)47(7)49(50)51-43-42-45(5)44(3)4)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-2/h16-19,22-25,44-48H,8-15,20-21,26-43H2,1-7H3 |
| InChIKey | HNIDDTLHJGQEDY-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.26 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|